chemistry help needed?

B

Bianki Richards

New member
OK. So I have a ton of homework thats deadline is in a week or so. Problem is I'm going out of town tomorrow to somewhere that does not allow me to bring any electronics. I've actually completed 95% of work already minus 1 chapter. But considering I have 5 labs that i also have to do, i thought i'd post a few questions on here. YOU DON'T HAVE TO HELP, so don't write the smart *** comments telling me to do my own work. But if you do it'd be GREATLY appreciated.

19.What is the equilibrium expression for the reaction: CO (g) + 3 H2 (g) CH4 (g) + H20 (g)?
[CH4][H2O]/[CO][H2]3[CH4][H2O]/[CO][H2]
[CO][H2]3/[CH4][H2O]
20.What is the equilibrium expression for the oxidation of hydrogen to form water vapor? 2H2 (g) + O2 (g) 2 H2O (g)
[H2]2[O2]/[H2O]2[H2O]2/[H2]2[O2]
[H2O]/[H2][O2]
21.What is the equilibrium expression for the formation of nitrosyl bromide? 2 NO (g) + Br2 (g) 2 NOBr (g)
[NOBr]2/[NO]2[Br2][NOBr]/[NO][Br2]
[NO]2[Br2]/[NOBr]2
22.What is the equilibrium expression for the following reaction: NO (g) + O3 (g) O2 (g) + NO2 (g)?
[O2][NO]/[NO2][O3][NO][O3]/[O2][NO2]
[O2][NO2]/[NO][O3]
23.What is the equilibrium expression for the following reaction: CH4 (g) + Cl2 (g) CH3Cl (g) + HCl (g)?
[Cl2][CH3Cl]/[CH4][HCl][CH4][Cl2]/[CH3Cl][HCl]
[CH3Cl][HCl]/[CH4][Cl2]
24.What is the equilibrium expression for the following reaction: Hg (g) + I2 (g) HgI2 (g)?
[HgI2]/[Hg][I2][Hg][I2]/[HgI2]
[Hg]/[HgI2][I2]
 
Back
Top